C18H21N3O5S — CID 127771837
7-[3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 127771837) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 7-[3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-[3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 127771837 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 7-[3-(2,3-dihydro-1H-inden-5-ylsulfonyl)propanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C1NC(=O)N2CCN(C(=O)CCS(=O)(=O)c3ccc4c(c3)CCC4)CC12 |
| InChI | InChI=1S/C18H21N3O5S/c22-16(20-7-8-21-15(11-20)17(23)19-18(21)24)6-9-27(25,26)14-5-4-12-2-1-3-13(12)10-14/h4-5,10,15H,1-3,6-9,11H2,(H,19,23,24) |
| InChIKey | FTKHYHRLVBESFL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|