C9H8N2O2 — CID 12777256
5-(4-methylphenyl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 12777256) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(4-methylphenyl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 12777256 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 5-(4-methylphenyl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | Cc1ccc(-c2n[nH]c(=O)o2)cc1 |
| InChI | InChI=1S/C9H8N2O2/c1-6-2-4-7(5-3-6)8-10-11-9(12)13-8/h2-5H,1H3,(H,11,12) |
| InChIKey | DYYZGRGLBXGSSQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |