C8H6N2OS — CID 735254
5-phenyl-3H-1,3,4-oxadiazole-2-thione (PubChem CID 735254) has the molecular formula C8H6N2OS and a molecular weight of 178.22 g/mol. Its IUPAC name is 5-phenyl-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-phenyl-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 735254 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 5-phenyl-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2ccccc2)o1 |
| InChI | InChI=1S/C8H6N2OS/c12-8-10-9-7(11-8)6-4-2-1-3-5-6/h1-5H,(H,10,12) |
| InChIKey | FOHWXVBZGSVUGO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|