C9H8N2OS — CID 774385
5-(2-methylphenyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 774385) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 5-(2-methylphenyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-methylphenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 774385 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 5-(2-methylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccccc1-c1n[nH]c(=S)o1 |
| InChI | InChI=1S/C9H8N2OS/c1-6-4-2-3-5-7(6)8-10-11-9(13)12-8/h2-5H,1H3,(H,11,13) |
| InChIKey | HNFIJWNVPWXSOL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|