C7H8IN3O2 — CID 12778118
2-iodo-N-(1-methyl-6-oxopyrimidin-4-yl)acetamide (PubChem CID 12778118) has the molecular formula C7H8IN3O2 and a molecular weight of 293.06 g/mol. Its IUPAC name is 2-iodo-N-(1-methyl-6-oxopyrimidin-4-yl)acetamide.
| Compound Name | 2-iodo-N-(1-methyl-6-oxopyrimidin-4-yl)acetamide |
|---|---|
| PubChem CID | 12778118 |
| Molecular Formula | C7H8IN3O2 |
| Molecular Weight | 293.06 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2-iodo-N-(1-methyl-6-oxopyrimidin-4-yl)acetamide |
| SMILES | Cn1cnc(NC(=O)CI)cc1=O |
| InChI | InChI=1S/C7H8IN3O2/c1-11-4-9-5(2-7(11)13)10-6(12)3-8/h2,4H,3H2,1H3,(H,10,12) |
| InChIKey | GJSZFXPXMBMSEO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.06 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|