C18H14N4O3 — CID 110728536
2-(1,3-dioxoisoindol-2-yl)-N-(1-methylbenzimidazol-5-yl)acetamide (PubChem CID 110728536) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(1-methylbenzimidazol-5-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1-methylbenzimidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110728536 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1-methylbenzimidazol-5-yl)acetamide |
| SMILES | Cn1cnc2cc(NC(=O)CN3C(=O)c4ccccc4C3=O)ccc21 |
| InChI | InChI=1S/C18H14N4O3/c1-21-10-19-14-8-11(6-7-15(14)21)20-16(23)9-22-17(24)12-4-2-3-5-13(12)18(22)25/h2-8,10H,9H2,1H3,(H,20,23) |
| InChIKey | CNKVRMSHWQVTIN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|