C13H21F3N4O3 — CID 127798821
4-hydroxy-N-[2-(3-oxopiperazin-1-yl)ethyl]-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 127798821) has the molecular formula C13H21F3N4O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-hydroxy-N-[2-(3-oxopiperazin-1-yl)ethyl]-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | 4-hydroxy-N-[2-(3-oxopiperazin-1-yl)ethyl]-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127798821 |
| Molecular Formula | C13H21F3N4O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-hydroxy-N-[2-(3-oxopiperazin-1-yl)ethyl]-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | O=C1CN(CCNC(=O)N2CCC(O)(C(F)(F)F)CC2)CCN1 |
| InChI | InChI=1S/C13H21F3N4O3/c14-13(15,16)12(23)1-5-20(6-2-12)11(22)18-4-8-19-7-3-17-10(21)9-19/h23H,1-9H2,(H,17,21)(H,18,22) |
| InChIKey | LMZTYLHMVVFQJA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |