C21H40ClN — CID 12779948
N-(3,3-dicyclohexylpropyl)cyclohexanamine;hydrochloride (PubChem CID 12779948) has the molecular formula C21H40ClN and a molecular weight of 342.01 g/mol. Its IUPAC name is N-(3,3-dicyclohexylpropyl)cyclohexanamine;hydrochloride.
| Compound Name | N-(3,3-dicyclohexylpropyl)cyclohexanamine;hydrochloride |
|---|---|
| PubChem CID | 12779948 |
| Molecular Formula | C21H40ClN |
| Molecular Weight | 342.01 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | N-(3,3-dicyclohexylpropyl)cyclohexanamine;hydrochloride |
| SMILES | C1CCC(NCCC(C2CCCCC2)C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C21H39N.ClH/c1-4-10-18(11-5-1)21(19-12-6-2-7-13-19)16-17-22-20-14-8-3-9-15-20;/h18-22H,1-17H2;1H |
| InChIKey | TYHGCVCQEZXUBM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.01 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |