C9H16N2O3S — CID 127799605
1-(cyclopentanecarbonyl)azetidine-3-sulfonamide (PubChem CID 127799605) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(cyclopentanecarbonyl)azetidine-3-sulfonamide.
| Compound Name | 1-(cyclopentanecarbonyl)azetidine-3-sulfonamide |
|---|---|
| PubChem CID | 127799605 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-(cyclopentanecarbonyl)azetidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C9H16N2O3S/c10-15(13,14)8-5-11(6-8)9(12)7-3-1-2-4-7/h7-8H,1-6H2,(H2,10,13,14) |
| InChIKey | BQDPRKKRCRCPFL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |