C13H22N2O — CID 124617878
[(3aS,4R,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclopentylmethanone (PubChem CID 124617878) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is [(3aS,4R,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclopentylmethanone.
| Compound Name | [(3aS,4R,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 124617878 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | [(3aS,4R,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclopentylmethanone |
| SMILES | N[C@@H]1CC[C@@H]2CN(C(=O)C3CCCC3)C[C@H]21 |
| InChI | InChI=1S/C13H22N2O/c14-12-6-5-10-7-15(8-11(10)12)13(16)9-3-1-2-4-9/h9-12H,1-8,14H2/t10-,11-,12-/m1/s1 |
| InChIKey | WALAXMSPGJGGGP-IJLUTSLNSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |