C14H23NO3 — CID 154564170
[(3aR,4R,5S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclobutylmethanone (PubChem CID 154564170) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is [(3aR,4R,5S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclobutylmethanone.
| Compound Name | [(3aR,4R,5S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 154564170 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [(3aR,4R,5S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1C[C@@H]2C[C@H](CO)[C@H](CO)[C@@H]2C1 |
| InChI | InChI=1S/C14H23NO3/c16-7-11-4-10-5-15(6-12(10)13(11)8-17)14(18)9-2-1-3-9/h9-13,16-17H,1-8H2/t10-,11+,12+,13-/m0/s1 |
| InChIKey | ZGOGTFRFCNHOEM-LOWDOPEQSA-N |
| XLogP | 0.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |