C13H23ClN2O — CID 86815216
(4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-[(1S)-2,2-dimethylcyclopropyl]methanone;hydrochloride (PubChem CID 86815216) has the molecular formula C13H23ClN2O and a molecular weight of 258.79 g/mol. Its IUPAC name is (4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-[(1S)-2,2-dimethylcyclopropyl]methanone;hydrochloride.
| Compound Name | (4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-[(1S)-2,2-dimethylcyclopropyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 86815216 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-[(1S)-2,2-dimethylcyclopropyl]methanone;hydrochloride |
| SMILES | CC1(C)C[C@@H]1C(=O)N1CC2CCC(N)C2C1.Cl |
| InChI | InChI=1S/C13H22N2O.ClH/c1-13(2)5-10(13)12(16)15-6-8-3-4-11(14)9(8)7-15;/h8-11H,3-7,14H2,1-2H3;1H/t8?,9?,10-,11?;/m1./s1 |
| InChIKey | SAGJEDRLTLHIOC-ICUJZDICSA-N |
| XLogP | 1.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |