C14H24N2OS — CID 113414698
(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(thian-2-yl)methanone (PubChem CID 113414698) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(thian-2-yl)methanone.
| Compound Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(thian-2-yl)methanone |
|---|---|
| PubChem CID | 113414698 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(thian-2-yl)methanone |
| SMILES | NC1CCCC2CN(C(=O)C3CCCCS3)CC12 |
| InChI | InChI=1S/C14H24N2OS/c15-12-5-3-4-10-8-16(9-11(10)12)14(17)13-6-1-2-7-18-13/h10-13H,1-9,15H2 |
| InChIKey | BRPAMRMAUCZSTD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |