C13H17F3N6 — CID 127807229
1-[(1-methyltriazol-4-yl)methyl]-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine (PubChem CID 127807229) has the molecular formula C13H17F3N6 and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-[(1-methyltriazol-4-yl)methyl]-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine.
| Compound Name | 1-[(1-methyltriazol-4-yl)methyl]-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine |
|---|---|
| PubChem CID | 127807229 |
| Molecular Formula | C13H17F3N6 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[(1-methyltriazol-4-yl)methyl]-3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine |
| SMILES | Cn1cc(CN2CCCC(n3ccc(C(F)(F)F)n3)C2)nn1 |
| InChI | InChI=1S/C13H17F3N6/c1-20-7-10(17-19-20)8-21-5-2-3-11(9-21)22-6-4-12(18-22)13(14,15)16/h4,6-7,11H,2-3,5,8-9H2,1H3 |
| InChIKey | ZUHOMQCZXQICET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |