C17H28N6O — CID 136585137
(3R)-3-methyl-4-[[1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazol-4-yl]methyl]morpholine (PubChem CID 136585137) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is (3R)-3-methyl-4-[[1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazol-4-yl]methyl]morpholine.
| Compound Name | (3R)-3-methyl-4-[[1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 136585137 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (3R)-3-methyl-4-[[1-[(1-pentan-3-ylpyrazol-3-yl)methyl]triazol-4-yl]methyl]morpholine |
| SMILES | CCC(CC)n1ccc(Cn2cc(CN3CCOC[C@H]3C)nn2)n1 |
| InChI | InChI=1S/C17H28N6O/c1-4-17(5-2)23-7-6-15(19-23)11-22-12-16(18-20-22)10-21-8-9-24-13-14(21)3/h6-7,12,14,17H,4-5,8-11,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | BERNJUCRQZSQNL-CQSZACIVSA-N |
| XLogP | 2.10 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |