C11H11NO — CID 12781824
3-methyl-5-phenyl-2H-1,4-oxazine (PubChem CID 12781824) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-methyl-5-phenyl-2H-1,4-oxazine.
| Compound Name | 3-methyl-5-phenyl-2H-1,4-oxazine |
|---|---|
| PubChem CID | 12781824 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-methyl-5-phenyl-2H-1,4-oxazine |
| SMILES | CC1=NC(c2ccccc2)=COC1 |
| InChI | InChI=1S/C11H11NO/c1-9-7-13-8-11(12-9)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | QVQFYNBEUWADMO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |