C16H14NO- — CID 134841892
(E)-[6-[(E)-1-phenylprop-1-enyl]iminocyclohexa-2,4-dien-1-ylidene]methanolate (PubChem CID 134841892) has the molecular formula C16H14NO- and a molecular weight of 236.29 g/mol. Its IUPAC name is (E)-[6-[(E)-1-phenylprop-1-enyl]iminocyclohexa-2,4-dien-1-ylidene]methanolate.
| Compound Name | (E)-[6-[(E)-1-phenylprop-1-enyl]iminocyclohexa-2,4-dien-1-ylidene]methanolate |
|---|---|
| PubChem CID | 134841892 |
| Molecular Formula | C16H14NO- |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (E)-[6-[(E)-1-phenylprop-1-enyl]iminocyclohexa-2,4-dien-1-ylidene]methanolate |
| SMILES | C/C=C(/N=C1\C=CC=C\C1=C/[O-])c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-2-15(13-8-4-3-5-9-13)17-16-11-7-6-10-14(16)12-18/h2-12,18H,1H3/p-1/b14-12+,15-2+,17-16+ |
| InChIKey | YNINNRGHYKUVEA-YWHWHSQTSA-M |
| XLogP | 2.86 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|