C33H26N2O3 — CID 1278557
N-(2,6-dimethylphenyl)-3-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide (PubChem CID 1278557) has the molecular formula C33H26N2O3 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide.
| Compound Name | N-(2,6-dimethylphenyl)-3-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide |
|---|---|
| PubChem CID | 1278557 |
| Molecular Formula | C33H26N2O3 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cccc(N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C33H26N2O3/c1-18-9-7-10-19(2)30(18)34-31(36)20-11-8-12-21(17-20)35-32(37)28-26-22-13-3-4-14-23(22)27(29(28)33(35)38)25-16-6-5-15-24(25)26/h3-17,26-29H,1-2H3,(H,34,36)/t26?,27?,28-,29+ |
| InChIKey | VEGBQDIJOSNDLX-FZDFQQAASA-N |
| XLogP | 5.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|