C10H12N4O2 — CID 127863676
2-(oxolan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 127863676) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(oxolan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 127863676 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CC2CCOC2)nc2cnccn12 |
| InChI | InChI=1S/C10H12N4O2/c15-10-13-3-2-11-5-9(13)12-14(10)6-8-1-4-16-7-8/h2-3,5,8H,1,4,6-7H2 |
| InChIKey | YFUGKPPJWQNIOG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |