About 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one
2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66273453) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
Analyze 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one?
The IUPAC name of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (CID 66273453) is 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
What is the SMILES notation for 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one?
The canonical SMILES for 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one is NCCn1nc2cnccn2c1=O.
What is the InChIKey of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one?
The InChIKey is ZTGBEPFQZBPZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c8-1-3-12-7(13)11-4-2-9-5-6(11)10-12/h2,4-5H,1,3,8H2.
What are the key properties of 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one?
2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one has a molecular weight of 179.18 g/mol, XLogP of -1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one is sourced from PubChem (CID 66273453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).