C9H12N4O2 — CID 66271761
2-(4-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66271761) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(4-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(4-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66271761 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(4-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CCCCO)nc2cnccn12 |
| InChI | InChI=1S/C9H12N4O2/c14-6-2-1-4-13-9(15)12-5-3-10-7-8(12)11-13/h3,5,7,14H,1-2,4,6H2 |
| InChIKey | CUHIADMIDJHOLQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|