C13H13N5O2 — CID 66271314
2-[2-(2-aminophenoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66271314) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[2-(2-aminophenoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[2-(2-aminophenoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66271314 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[2-(2-aminophenoxy)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | Nc1ccccc1OCCn1nc2cnccn2c1=O |
| InChI | InChI=1S/C13H13N5O2/c14-10-3-1-2-4-11(10)20-8-7-18-13(19)17-6-5-15-9-12(17)16-18/h1-6,9H,7-8,14H2 |
| InChIKey | ROMITYCPSZXXDI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|