C11H11N7O — CID 66272198
2-[(2-hydrazinyl-3-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66272198) has the molecular formula C11H11N7O and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[(2-hydrazinyl-3-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[(2-hydrazinyl-3-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66272198 |
| Molecular Formula | C11H11N7O |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[(2-hydrazinyl-3-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | NNc1ncccc1Cn1nc2cnccn2c1=O |
| InChI | InChI=1S/C11H11N7O/c12-15-10-8(2-1-3-14-10)7-18-11(19)17-5-4-13-6-9(17)16-18/h1-6H,7,12H2,(H,14,15) |
| InChIKey | VEDNFGSUKYYEAE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|