C11H10N6O3 — CID 66273065
2-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]furan-3-carbohydrazide (PubChem CID 66273065) has the molecular formula C11H10N6O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 2-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 66273065 |
| Molecular Formula | C11H10N6O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1ccoc1Cn1nc2cnccn2c1=O |
| InChI | InChI=1S/C11H10N6O3/c12-14-10(18)7-1-4-20-8(7)6-17-11(19)16-3-2-13-5-9(16)15-17/h1-5H,6,12H2,(H,14,18) |
| InChIKey | KKMSUWCKJOICQK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 120.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|