C11H10ClN7O — CID 66272199
2-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66272199) has the molecular formula C11H10ClN7O and a molecular weight of 291.70 g/mol. Its IUPAC name is 2-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66272199 |
| Molecular Formula | C11H10ClN7O |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | NNc1ccc(Cl)c(Cn2nc3cnccn3c2=O)n1 |
| InChI | InChI=1S/C11H10ClN7O/c12-7-1-2-9(16-13)15-8(7)6-19-11(20)18-4-3-14-5-10(18)17-19/h1-5H,6,13H2,(H,15,16) |
| InChIKey | MFKOHSPWJMOLAM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|