C13H14N6O — CID 66272841
2-[2-(pyridin-3-ylmethylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66272841) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-[2-(pyridin-3-ylmethylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[2-(pyridin-3-ylmethylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66272841 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[2-(pyridin-3-ylmethylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CCNCc2cccnc2)nc2cnccn12 |
| InChI | InChI=1S/C13H14N6O/c20-13-18-6-4-16-10-12(18)17-19(13)7-5-15-9-11-2-1-3-14-8-11/h1-4,6,8,10,15H,5,7,9H2 |
| InChIKey | AFLCCDBKKMBDLP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|