C16H20ClN3O2S — CID 127879522
N-[(3-chlorophenyl)-cyclopentylmethyl]-2-methylpyrazole-3-sulfonamide (PubChem CID 127879522) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-cyclopentylmethyl]-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-[(3-chlorophenyl)-cyclopentylmethyl]-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 127879522 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(3-chlorophenyl)-cyclopentylmethyl]-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NC(c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-20-15(9-10-18-20)23(21,22)19-16(12-5-2-3-6-12)13-7-4-8-14(17)11-13/h4,7-12,16,19H,2-3,5-6H2,1H3 |
| InChIKey | NFROLTPTTKKFIU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |