C9H12N2O2S — CID 127895292
4-(3-methylpyrrolidine-1-carbonyl)-3H-1,3-thiazol-2-one (PubChem CID 127895292) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-(3-methylpyrrolidine-1-carbonyl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(3-methylpyrrolidine-1-carbonyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 127895292 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-(3-methylpyrrolidine-1-carbonyl)-3H-1,3-thiazol-2-one |
| SMILES | CC1CCN(C(=O)c2csc(=O)[nH]2)C1 |
| InChI | InChI=1S/C9H12N2O2S/c1-6-2-3-11(4-6)8(12)7-5-14-9(13)10-7/h5-6H,2-4H2,1H3,(H,10,13) |
| InChIKey | LAIRIBMUZXLZQT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |