C20H32N6O — CID 127917847
N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide (PubChem CID 127917847) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide.
| Compound Name | N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127917847 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCC(c2nnc3n2CCCC3)CC1)C1=CCN(C)CC1 |
| InChI | InChI=1S/C20H32N6O/c1-15(16-6-11-24(2)12-7-16)21-20(27)25-13-8-17(9-14-25)19-23-22-18-5-3-4-10-26(18)19/h6,15,17H,3-5,7-14H2,1-2H3,(H,21,27) |
| InChIKey | ISMAEMUHZJHYOI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|