C25H28ClN3O2 — CID 12793394
(Z)-3-[2-[3-(azepan-1-yl)propoxy]phenyl]-2-(1,2-benzoxazol-3-yl)prop-2-enenitrile;hydrochloride (PubChem CID 12793394) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is (Z)-3-[2-[3-(azepan-1-yl)propoxy]phenyl]-2-(1,2-benzoxazol-3-yl)prop-2-enenitrile;hydrochloride.
| Compound Name | (Z)-3-[2-[3-(azepan-1-yl)propoxy]phenyl]-2-(1,2-benzoxazol-3-yl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 12793394 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | (Z)-3-[2-[3-(azepan-1-yl)propoxy]phenyl]-2-(1,2-benzoxazol-3-yl)prop-2-enenitrile;hydrochloride |
| SMILES | Cl.N#C/C(=C\c1ccccc1OCCCN1CCCCCC1)c1noc2ccccc12 |
| InChI | InChI=1S/C25H27N3O2.ClH/c26-19-21(25-22-11-4-6-13-24(22)30-27-25)18-20-10-3-5-12-23(20)29-17-9-16-28-14-7-1-2-8-15-28;/h3-6,10-13,18H,1-2,7-9,14-17H2;1H/b21-18+; |
| InChIKey | LGYKIMCENGIWBQ-GOSREXKOSA-N |
| XLogP | 5.96 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|