C23H24ClN3O3 — CID 12793396
(Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(3-morpholin-4-ylpropoxy)phenyl]prop-2-enenitrile;hydrochloride (PubChem CID 12793396) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(3-morpholin-4-ylpropoxy)phenyl]prop-2-enenitrile;hydrochloride.
| Compound Name | (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(3-morpholin-4-ylpropoxy)phenyl]prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 12793396 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (Z)-2-(1,2-benzoxazol-3-yl)-3-[2-(3-morpholin-4-ylpropoxy)phenyl]prop-2-enenitrile;hydrochloride |
| SMILES | Cl.N#C/C(=C\c1ccccc1OCCCN1CCOCC1)c1noc2ccccc12 |
| InChI | InChI=1S/C23H23N3O3.ClH/c24-17-19(23-20-7-2-4-9-22(20)29-25-23)16-18-6-1-3-8-21(18)28-13-5-10-26-11-14-27-15-12-26;/h1-4,6-9,16H,5,10-15H2;1H/b19-16+; |
| InChIKey | HDMRMDLLYIBTAX-PXMDEAMVSA-N |
| XLogP | 4.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|