C18H30N6O — CID 12797468
N-[3-[3-[(hexylamino)methyl]phenoxy]propyl]-1-methyltetrazol-5-amine (PubChem CID 12797468) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[3-[3-[(hexylamino)methyl]phenoxy]propyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[3-[3-[(hexylamino)methyl]phenoxy]propyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 12797468 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | N-[3-[3-[(hexylamino)methyl]phenoxy]propyl]-1-methyltetrazol-5-amine |
| SMILES | CCCCCCNCc1cccc(OCCCNc2nnnn2C)c1 |
| InChI | InChI=1S/C18H30N6O/c1-3-4-5-6-11-19-15-16-9-7-10-17(14-16)25-13-8-12-20-18-21-22-23-24(18)2/h7,9-10,14,19H,3-6,8,11-13,15H2,1-2H3,(H,20,21,23) |
| InChIKey | ZDZDHODPFAIGRQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|