C25H43N7O2 — CID 70484422
2-[[3-[3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]propoxy]phenyl]methylamino]-N-decylacetamide (PubChem CID 70484422) has the molecular formula C25H43N7O2 and a molecular weight of 473.67 g/mol. Its IUPAC name is 2-[[3-[3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]propoxy]phenyl]methylamino]-N-decylacetamide.
| Compound Name | 2-[[3-[3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]propoxy]phenyl]methylamino]-N-decylacetamide |
|---|---|
| PubChem CID | 70484422 |
| Molecular Formula | C25H43N7O2 |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | 2-[[3-[3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)amino]propoxy]phenyl]methylamino]-N-decylacetamide |
| SMILES | CCCCCCCCCCNC(=O)CNCc1cccc(OCCCNc2nc(N)nn2C)c1 |
| InChI | InChI=1S/C25H43N7O2/c1-3-4-5-6-7-8-9-10-15-28-23(33)20-27-19-21-13-11-14-22(18-21)34-17-12-16-29-25-30-24(26)31-32(25)2/h11,13-14,18,27H,3-10,12,15-17,19-20H2,1-2H3,(H,28,33)(H3,26,29,30,31) |
| InChIKey | KTFCNBXBKSTMTR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|