C19H28N6O2 — CID 12774367
1-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazole-3-carboxamide (PubChem CID 12774367) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 12774367 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1nc(C(N)=O)nc1NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C19H28N6O2/c1-24-19(22-18(23-24)17(20)26)21-9-6-12-27-16-8-5-7-15(13-16)14-25-10-3-2-4-11-25/h5,7-8,13H,2-4,6,9-12,14H2,1H3,(H2,20,26)(H,21,22,23) |
| InChIKey | LIWYUOBPUXHCAJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|