C24H31ClN6OS — CID 13490959
3-N-(4-chlorophenyl)sulfanyl-1-methyl-5-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-3,5-diamine (PubChem CID 13490959) has the molecular formula C24H31ClN6OS and a molecular weight of 487.07 g/mol. Its IUPAC name is 3-N-(4-chlorophenyl)sulfanyl-1-methyl-5-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(4-chlorophenyl)sulfanyl-1-methyl-5-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 13490959 |
| Molecular Formula | C24H31ClN6OS |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 3-N-(4-chlorophenyl)sulfanyl-1-methyl-5-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-3,5-diamine |
| SMILES | Cn1nc(NSc2ccc(Cl)cc2)nc1NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C24H31ClN6OS/c1-30-24(27-23(28-30)29-33-22-11-9-20(25)10-12-22)26-13-6-16-32-21-8-5-7-19(17-21)18-31-14-3-2-4-15-31/h5,7-12,17H,2-4,6,13-16,18H2,1H3,(H2,26,27,28,29) |
| InChIKey | WTRQIJSDDMANNV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|