C20H28KN5O3 — CID 70484436
potassium 2-[4-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazol-3-yl]acetate (PubChem CID 70484436) has the molecular formula C20H28KN5O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is potassium 2-[4-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazol-3-yl]acetate.
| Compound Name | potassium 2-[4-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 70484436 |
| Molecular Formula | C20H28KN5O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | potassium 2-[4-methyl-5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,2,4-triazol-3-yl]acetate |
| SMILES | Cn1c(CC(=O)[O-])nnc1NCCCOc1cccc(CN2CCCCC2)c1.[K+] |
| InChI | InChI=1S/C20H29N5O3.K/c1-24-18(14-19(26)27)22-23-20(24)21-9-6-12-28-17-8-5-7-16(13-17)15-25-10-3-2-4-11-25;/h5,7-8,13H,2-4,6,9-12,14-15H2,1H3,(H,21,23)(H,26,27);/q;+1/p-1 |
| InChIKey | UEUJMLNHUXWNJO-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|