C26H32N4O3 — CID 21283054
3-[(6-methyl-3-pyridinyl)methylamino]-4-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 21283054) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 3-[(6-methyl-3-pyridinyl)methylamino]-4-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(6-methyl-3-pyridinyl)methylamino]-4-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 21283054 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 3-[(6-methyl-3-pyridinyl)methylamino]-4-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(CNc2c(NCCCOc3cccc(CN4CCCCC4)c3)c(=O)c2=O)cn1 |
| InChI | InChI=1S/C26H32N4O3/c1-19-9-10-21(16-28-19)17-29-24-23(25(31)26(24)32)27-11-6-14-33-22-8-5-7-20(15-22)18-30-12-3-2-4-13-30/h5,7-10,15-16,27,29H,2-4,6,11-14,17-18H2,1H3 |
| InChIKey | XMTPJWNKUDUVEL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|