C22H31N5O4 — CID 14326694
ethyl N-[6-oxo-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-pyrimidin-5-yl]carbamate (PubChem CID 14326694) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl N-[6-oxo-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-pyrimidin-5-yl]carbamate.
| Compound Name | ethyl N-[6-oxo-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 14326694 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | ethyl N-[6-oxo-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1H-pyrimidin-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1cnc(NCCCOc2cccc(CN3CCCCC3)c2)[nH]c1=O |
| InChI | InChI=1S/C22H31N5O4/c1-2-30-22(29)25-19-15-24-21(26-20(19)28)23-10-7-13-31-18-9-6-8-17(14-18)16-27-11-4-3-5-12-27/h6,8-9,14-15H,2-5,7,10-13,16H2,1H3,(H,25,29)(H2,23,24,26,28) |
| InChIKey | RLOWMFIZVFMWBI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|