C21H31N5O3 — CID 12774365
ethyl 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]butylamino]-1H-1,2,4-triazole-5-carboxylate (PubChem CID 12774365) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is ethyl 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]butylamino]-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]butylamino]-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 12774365 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | ethyl 3-[4-[3-(piperidin-1-ylmethyl)phenoxy]butylamino]-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(NCCCCOc2cccc(CN3CCCCC3)c2)n[nH]1 |
| InChI | InChI=1S/C21H31N5O3/c1-2-28-20(27)19-23-21(25-24-19)22-11-4-7-14-29-18-10-8-9-17(15-18)16-26-12-5-3-6-13-26/h8-10,15H,2-7,11-14,16H2,1H3,(H2,22,23,24,25) |
| InChIKey | HYJCGRMJIRPKIT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|