C18H29N5O2S — CID 57040317
[methyl-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylcarbamothioyl]amino]urea (PubChem CID 57040317) has the molecular formula C18H29N5O2S and a molecular weight of 379.53 g/mol. Its IUPAC name is [methyl-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylcarbamothioyl]amino]urea.
| Compound Name | [methyl-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylcarbamothioyl]amino]urea |
|---|---|
| PubChem CID | 57040317 |
| Molecular Formula | C18H29N5O2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [methyl-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylcarbamothioyl]amino]urea |
| SMILES | CN(NC(N)=O)C(=S)NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C18H29N5O2S/c1-22(21-17(19)24)18(26)20-9-6-12-25-16-8-5-7-15(13-16)14-23-10-3-2-4-11-23/h5,7-8,13H,2-4,6,9-12,14H2,1H3,(H,20,26)(H3,19,21,24) |
| InChIKey | QCAIUHYWKKZPMI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|