C29H37N3O10 — CID 159735742
bis((Z)-but-2-enedioic acid);3-methoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine (PubChem CID 159735742) has the molecular formula C29H37N3O10 and a molecular weight of 587.63 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);3-methoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine.
| Compound Name | bis((Z)-but-2-enedioic acid);3-methoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 159735742 |
| Molecular Formula | C29H37N3O10 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);3-methoxy-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pyridin-2-amine |
| SMILES | COc1cccnc1NCCCOc1cccc(CN2CCCCC2)c1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H29N3O2.2C4H4O4/c1-25-20-10-6-11-22-21(20)23-12-7-15-26-19-9-5-8-18(16-19)17-24-13-3-2-4-14-24;2*5-3(6)1-2-4(7)8/h5-6,8-11,16H,2-4,7,12-15,17H2,1H3,(H,22,23);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | NBUXGAJZIUIOMS-SPIKMXEPSA-N |
| XLogP | 3.38 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|