C8H10FN3O3 — CID 12799737
N-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanamide (PubChem CID 12799737) has the molecular formula C8H10FN3O3 and a molecular weight of 215.18 g/mol. Its IUPAC name is N-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanamide.
| Compound Name | N-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanamide |
|---|---|
| PubChem CID | 12799737 |
| Molecular Formula | C8H10FN3O3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanamide |
| SMILES | CCCC(=O)Nn1c(=O)[nH]cc(F)c1=O |
| InChI | InChI=1S/C8H10FN3O3/c1-2-3-6(13)11-12-7(14)5(9)4-10-8(12)15/h4H,2-3H2,1H3,(H,10,15)(H,11,13) |
| InChIKey | SAVBTPSHCMNKFU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |