C21H30BrN — CID 12805096
1-[(E)-2-(3-bromophenyl)prop-1-enyl]-2-(cyclohexylmethyl)piperidine (PubChem CID 12805096) has the molecular formula C21H30BrN and a molecular weight of 376.38 g/mol. Its IUPAC name is 1-[(E)-2-(3-bromophenyl)prop-1-enyl]-2-(cyclohexylmethyl)piperidine.
| Compound Name | 1-[(E)-2-(3-bromophenyl)prop-1-enyl]-2-(cyclohexylmethyl)piperidine |
|---|---|
| PubChem CID | 12805096 |
| Molecular Formula | C21H30BrN |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[(E)-2-(3-bromophenyl)prop-1-enyl]-2-(cyclohexylmethyl)piperidine |
| SMILES | C/C(=C\N1CCCCC1CC1CCCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H30BrN/c1-17(19-10-7-11-20(22)15-19)16-23-13-6-5-12-21(23)14-18-8-3-2-4-9-18/h7,10-11,15-16,18,21H,2-6,8-9,12-14H2,1H3/b17-16+ |
| InChIKey | LKZNAUICPFILSU-WUKNDPDISA-N |
| XLogP | 6.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |