C18H23BrN2O — CID 91458806
1-(3-bromophenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 91458806) has the molecular formula C18H23BrN2O and a molecular weight of 363.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-(3-bromophenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91458806 |
| Molecular Formula | C18H23BrN2O |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-(3-bromophenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCC[C@H]1CN1CCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H23BrN2O/c19-16-6-3-5-15(13-16)18(22)8-12-21-11-4-7-17(21)14-20-9-1-2-10-20/h3,5-6,8,12-13,17H,1-2,4,7,9-11,14H2/t17-/m0/s1 |
| InChIKey | DKARUYARXJBASC-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|