C24H28N2O — CID 91026256
1-(4-phenylphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 91026256) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-(4-phenylphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91026256 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-(4-phenylphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCC[C@H]1CN1CCCC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N2O/c27-24(22-12-10-21(11-13-22)20-7-2-1-3-8-20)14-18-26-17-6-9-23(26)19-25-15-4-5-16-25/h1-3,7-8,10-14,18,23H,4-6,9,15-17,19H2/t23-/m0/s1 |
| InChIKey | NHBSBVMJOYXGAJ-QHCPKHFHSA-N |
| XLogP | 4.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|