C20H28N2O3 — CID 91592886
1-(2,4-dimethoxyphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 91592886) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91592886 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=CN2CCC[C@H]2CN2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C20H28N2O3/c1-24-17-7-8-18(20(14-17)25-2)19(23)9-13-22-12-5-6-16(22)15-21-10-3-4-11-21/h7-9,13-14,16H,3-6,10-12,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | HAHNEIXRUZCYIO-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|