C39H68O5S — CID 12805535
2-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexylsulfanyl]-6-methyloxane-3,4,5-triol (PubChem CID 12805535) has the molecular formula C39H68O5S and a molecular weight of 649.04 g/mol. Its IUPAC name is 2-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexylsulfanyl]-6-methyloxane-3,4,5-triol.
| Compound Name | 2-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexylsulfanyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 12805535 |
| Molecular Formula | C39H68O5S |
| Molecular Weight | 649.04 g/mol |
| Exact Mass | 648.48 |
| IUPAC Name | 2-[6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hexylsulfanyl]-6-methyloxane-3,4,5-triol |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OCCCCCCSC5OC(C)C(O)C(O)C5O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C39H68O5S/c1-25(2)12-11-13-26(3)31-16-17-32-30-15-14-28-24-29(18-20-38(28,5)33(30)19-21-39(31,32)6)43-22-9-7-8-10-23-45-37-36(42)35(41)34(40)27(4)44-37/h14,25-27,29-37,40-42H,7-13,15-24H2,1-6H3 |
| InChIKey | DJYQLUJISFGKCW-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.04 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|