C18H17IN2O — CID 12805652
2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol iodide (PubChem CID 12805652) has the molecular formula C18H17IN2O and a molecular weight of 404.25 g/mol. Its IUPAC name is 2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol iodide.
| Compound Name | 2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol iodide |
|---|---|
| PubChem CID | 12805652 |
| Molecular Formula | C18H17IN2O |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol iodide |
| SMILES | Cc1c2cc[n+](C)cc2c(C)c2c1[nH]c1ccc(O)cc12.[I-] |
| InChI | InChI=1S/C18H16N2O.HI/c1-10-15-9-20(3)7-6-13(15)11(2)18-17(10)14-8-12(21)4-5-16(14)19-18;/h4-9,21H,1-3H3;1H |
| InChIKey | VBYXSZHHBDXMNX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 39.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|