C16H13FO4 — CID 12812430
6-fluoro-4-methyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid (PubChem CID 12812430) has the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. Its IUPAC name is 6-fluoro-4-methyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid.
| Compound Name | 6-fluoro-4-methyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 12812430 |
| Molecular Formula | C16H13FO4 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 6-fluoro-4-methyl-4-phenyl-1,3-benzodioxine-2-carboxylic acid |
| SMILES | CC1(c2ccccc2)OC(C(=O)O)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C16H13FO4/c1-16(10-5-3-2-4-6-10)12-9-11(17)7-8-13(12)20-15(21-16)14(18)19/h2-9,15H,1H3,(H,18,19) |
| InChIKey | RXUBHAYSLKWGQM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |