C17H20N2O5S2 — CID 12813314
(4R)-3-[(2S)-3-(4-acetamidobenzoyl)sulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12813314) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (4R)-3-[(2S)-3-(4-acetamidobenzoyl)sulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[(2S)-3-(4-acetamidobenzoyl)sulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12813314 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (4R)-3-[(2S)-3-(4-acetamidobenzoyl)sulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)SC[C@@H](C)C(=O)N2CSC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-10(15(21)19-9-25-8-14(19)16(22)23)7-26-17(24)12-3-5-13(6-4-12)18-11(2)20/h3-6,10,14H,7-9H2,1-2H3,(H,18,20)(H,22,23)/t10-,14+/m1/s1 |
| InChIKey | LSUKIWHWQDCNEE-YGRLFVJLSA-N |
| XLogP | 2.14 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|